DNA, RNA and Protein Synthesis Compounds Products
31 results for "DNA, RNA and Protein Synthesis Compounds" in Products
Search
Application
Product Action
Conjugates
Low Endotoxin
Sample Size
Reviews
Brand
DNA, RNA and Protein Synthesis Compounds Products
31 results for "DNA, RNA and Protein Synthesis Compounds" in Products
Non-selective protein kinase inhibitor
| Alternate Names: | AM-2282 |
| Chemical Name: | [9S-(9α,10β,11β,13α)]-2,3,10,11,12,13-Hexahydro-10-methoxy-9-methyl-11-(methylamino)-9,13-epoxy-1H,9H-diindolo[1,2,3-gh:3',2',1'-lm]pyrrolo[3,4-j][1,7]benzodiazonin-1-one |
| Purity: | ≥98% (HPLC) |
Potent and selective herpes simplex virus (HSV) helicase primase inhibitor
| Chemical Name: | N-[5-(Aminosulfonyl)-4-methyl-2-thiazolyl]-N-methyl-4-(2-pyridinyl)benzeneacetamide |
| Purity: | ≥98% (HPLC) |
Alkylating agent; chemotherapeutic
| Chemical Name: | 2-[Bis(2-chloroethyl)amino]tetrahydro-2H-1,3,2-oxazaphosphorine 2-oxide |
| Purity: | ≥99% (HPLC) |
Selective orthosteric inhibitor of the BRCA2-RAD51 interaction
| Chemical Name: | N-(2-((2S,4R)-2-(((S)-1-(2-Chloro-4-methoxyphenyl)ethyl)carbamoyl)-4-hydroxypyrrolidin-1-yl)-2-oxoethyl)-6-fluoroquinoline-2-carboxamide |
| Purity: | ≥98% (HPLC) |
Antibiotic; inhibits 50S ribosomal subunit formation and elongation at transpeptidation
| Alternate Names: | CP 62993 |
| Chemical Name: | 13-[(2,6-Dideoxy-3-C-methyl-3-O-methyl-α-L-ribo-hexopyranosyl)oxy]-2-ethyl-3,4,10-trihydroxy-3,5,6,8,10,12,14-heptamethyl-11-[[3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranosyl]oxy]-1-oxa-6-azacyclopentadecan-15-one |
| Purity: | ≥99% (HPLC) |
Reagent for RNA SHAPE-MaP experiments in vivo; cell permeable
| Chemical Name: | (2-Aminopyridin-3-yl)(1H-imidazol-1-yl)methanone |
RNA conformation probe; reagent for COMRADES RNA platform
| Alternate Names: | psoralen-triethylene glycol azide |
| Chemical Name: | 3-(13-Azido-5,8,11-trioxa-2-azatridec-1-yl)-2,5,9-trimethyl-7H-furo[3,2-g][1]benzopyran-7-one |
| Purity: | ≥98% (HPLC) |
Uridine analog, used for labeling RNA synthesis
| Chemical Name: | 1-((2R,3R,4S,5R)-3,4-Dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-5-ethynylpyrimidine-2,4(1H,3H)-dione |
| Purity: | ≥98% (HPLC) |
Chemoproteomic reagent, clickable electrophilic purine for RNA binding profiling in live cells
| Chemical Name: | 2,6-Dichloro-7-(2-propyn-1-yl)-7H-purine |
| Purity: | ≥98% (HPLC) |
Thymidine analog for labeling DNA; can be linked to a fluorophore by click chemistry
| Chemical Name: | 5-ethynyl-1-((2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione |
| Purity: | ≥95% (HPLC) |
Reagent for RNA SHAPE-MaP chemistry
| Alternate Names: | 1-Methyl-7-nitroisatoic anhydride |
| Chemical Name: | 1-Methyl-7-nitro-2H-3,1-benzoxazine-2,4(1H)-dione |
| Purity: | ≥95% (HPLC) |
Bivalent SHAPE cross-linking reagent
| Alternate Names: | trans-bis-isatoic anhydride |
| Chemical Name: | 1,6-Dihydrobenzo[1,2-d:4,5-d']bis([1,3]oxazine)-2,4,7,9-tetraone |
| Purity: | ≥95% (HPLC) |
Molecular glue; pre-mRNA splicing modulator
| Chemical Name: | N1-(3-Chloro-1H-indol-7-yl)-1,4-benzenedisulfonamide |
| Purity: | ≥98% (HPLC) |
SHAPE-JuMP monoadduct control for TBIA (Cat. No. 7788)
| Chemical Name: | 1,2-Dihydro-3,1-benzoxazine-2,4-dione |
| Purity: | ≥95% (HPLC) |
IKBKAP pre-mRNA splicing modulator
| Chemical Name: | 2-Chloro-N-(2-furanylmethyl)-7H-purin-6-amine |
| Purity: | ≥98% (HPLC) |
Reagent for RNA SHAPE-MaP experiments in vivo; cell permeable
| Chemical Name: | 1H-Imidazol-1-yl(2-methyl-3-pyridinyl)methanone |
HIV RNA splicing modulator
| Chemical Name: | 8-Chloro-N-[4-(trifluoromethoxy)phenyl]-2-quinolinamine |
| Purity: | ≥98% (HPLC) |
eIF4A inhibitor
| Chemical Name: | 2-(5-(4-Butylphenyl)furan-2-yl)-6-nitroquinoline-4-carboxylic acid |
| Applications: | CellVia |
| Purity: | ≥98% (HPLC) |
Potent and selective DYRK1A inhibitor
| Chemical Name: | 7-Methoxy-1-methyl-9H-pyrido[3,4-b]indole |
| Purity: | ≥98% (HPLC) |
DNA topoisomerase I inhibitor; Camptothecin (Cat. No. 1100) analog
| Alternate Names: | SK&F 104864-A |
| Chemical Name: | 10-[(Dimethylamino)methyl]-4-ethyl-4,9-dihydroxy-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione hydrochloride |
| Purity: | ≥98% (HPLC) |
Cytostatic agent; exhibits DNA alkylating and purine analog properties
| Chemical Name: | 5-[Bis(2-chloroethyl)amino]-1-methyl-1H-benzimidazole-2-butanoic acid hydrochloride |
| Purity: | ≥98% (HPLC) |
Synthetic thymidine analog; used for cell proliferation assays
| Chemical Name: | 5-Bromo-2-deoxyuridine |
| Purity: | ≥99% (HPLC) |
Reagent for RNA SHAPE-MaP experiments in live cells
| Chemical Name: | 1H-Imidazol-1-yl(2-methyl-3-furanyl)methanone |
Potent flap endonuclease 1 (FEN1) inhibitor; induces DNA damage response
| Chemical Name: | 1-[(2,3-Dihydro-1,4-benzodioxin-2-yl)methyl]-3-hydroxythieno[3,2-d]pyrimidine-2,4(1H,3H)-dione |
| Purity: | ≥98% (HPLC) |
Reagent for modifying RNA at 2'-OH position, for SHAPE-MAP experiments
| Chemical Name: | 3-((1H-1,2,4-Triazol-1-yl)sulfonyl)pyridine |
| Purity: | ≥95% (HPLC) |
